C12H20O2 — CID 22965736
1-(2,2,6,6-tetramethyloxan-4-ylidene)propan-2-one (PubChem CID 22965736) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethyloxan-4-ylidene)propan-2-one.
| Compound Name | 1-(2,2,6,6-tetramethyloxan-4-ylidene)propan-2-one |
|---|---|
| PubChem CID | 22965736 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1-(2,2,6,6-tetramethyloxan-4-ylidene)propan-2-one |
| SMILES | CC(=O)C=C1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C12H20O2/c1-9(13)6-10-7-11(2,3)14-12(4,5)8-10/h6H,7-8H2,1-5H3 |
| InChIKey | OGLIQSWGIUDRAD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|