C16H25NO3 — CID 22965853
4-[(1E,3E)-5-cyclopentyloxy-4-methoxyhexa-1,3-dienyl]pyrrolidin-2-one (PubChem CID 22965853) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-[(1E,3E)-5-cyclopentyloxy-4-methoxyhexa-1,3-dienyl]pyrrolidin-2-one.
| Compound Name | 4-[(1E,3E)-5-cyclopentyloxy-4-methoxyhexa-1,3-dienyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 22965853 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 4-[(1E,3E)-5-cyclopentyloxy-4-methoxyhexa-1,3-dienyl]pyrrolidin-2-one |
| SMILES | CO/C(=C/C=C/C1CNC(=O)C1)C(C)OC1CCCC1 |
| InChI | InChI=1S/C16H25NO3/c1-12(20-14-7-3-4-8-14)15(19-2)9-5-6-13-10-16(18)17-11-13/h5-6,9,12-14H,3-4,7-8,10-11H2,1-2H3,(H,17,18)/b6-5+,15-9+ |
| InChIKey | DBPQMRIBHNQODQ-LODDJISYSA-N |
| XLogP | 2.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|