3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid

C8H14O5 — CID 22966559

IUPAC3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid
SMILESCC1OC(C(=O)O)C(O)C(O)C1C
InChIInChI=1S/C8H14O5/c1-3-4(2)13-7(8(11)12)6(10)5(3)9/h3-7,9-10H,1-2H3,(H,11,12)
InChIKeyCVXZHBNHNKRLOU-UHFFFAOYSA-N
MW190.19 g/mol
LogP-0.78
Rot. Bonds1

About 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid

3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid (PubChem CID 22966559) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid.

Molecular Properties

Compound Name3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid
PubChem CID22966559
Molecular FormulaC8H14O5
Molecular Weight190.19 g/mol
Exact Mass190.08
IUPAC Name3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid
SMILESCC1OC(C(=O)O)C(O)C(O)C1C
InChIInChI=1S/C8H14O5/c1-3-4(2)13-7(8(11)12)6(10)5(3)9/h3-7,9-10H,1-2H3,(H,11,12)
InChIKeyCVXZHBNHNKRLOU-UHFFFAOYSA-N
XLogP-0.78
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.19
LogP ≤ 5-0.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid?
The IUPAC name of 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid (CID 22966559) is 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid.
What is the SMILES notation for 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid?
The canonical SMILES for 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid is CC1OC(C(=O)O)C(O)C(O)C1C.
What is the InChIKey of 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid?
The InChIKey is CVXZHBNHNKRLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5/c1-3-4(2)13-7(8(11)12)6(10)5(3)9/h3-7,9-10H,1-2H3,(H,11,12).
What are the key properties of 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid?
3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid has a molecular weight of 190.19 g/mol, XLogP of -0.78, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-5,6-dimethyloxane-2-carboxylic acid is sourced from PubChem (CID 22966559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).