C33H21N2O6P — CID 22966632
1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenyl]pyrrole-2,5-dione (PubChem CID 22966632) has the molecular formula C33H21N2O6P and a molecular weight of 572.51 g/mol. Its IUPAC name is 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22966632 |
| Molecular Formula | C33H21N2O6P |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | 1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(C(c2ccc(N3C(=O)C=CC3=O)cc2)P2(=O)Oc3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C33H21N2O6P/c36-29-17-18-30(37)34(29)23-13-9-21(10-14-23)33(22-11-15-24(16-12-22)35-31(38)19-20-32(35)39)42(40)28-8-4-2-6-26(28)25-5-1-3-7-27(25)41-42/h1-20,33H |
| InChIKey | AHMNGXRYMRMBLC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|