C45H87N9 — CID 22966881
2-N,4-N,6-N-tributyl-2-N,4-N,6-N-tris(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 22966881) has the molecular formula C45H87N9 and a molecular weight of 754.25 g/mol. Its IUPAC name is 2-N,4-N,6-N-tributyl-2-N,4-N,6-N-tris(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tributyl-2-N,4-N,6-N-tris(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 22966881 |
| Molecular Formula | C45H87N9 |
| Molecular Weight | 754.25 g/mol |
| Exact Mass | 753.71 |
| IUPAC Name | 2-N,4-N,6-N-tributyl-2-N,4-N,6-N-tris(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(CCCC)C2CC(C)(C)N(C)C(C)(C)C2)n1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C45H87N9/c1-19-22-25-52(34-28-40(4,5)49(16)41(6,7)29-34)37-46-38(53(26-23-20-2)35-30-42(8,9)50(17)43(10,11)31-35)48-39(47-37)54(27-24-21-3)36-32-44(12,13)51(18)45(14,15)33-36/h34-36H,19-33H2,1-18H3 |
| InChIKey | KLSFLIMTKGMCGS-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 58.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.25 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |