C30H60N4O2 — CID 22966887
N-[6-[methoxymethyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexyl]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)acetamide (PubChem CID 22966887) has the molecular formula C30H60N4O2 and a molecular weight of 508.84 g/mol. Its IUPAC name is N-[6-[methoxymethyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexyl]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)acetamide.
| Compound Name | N-[6-[methoxymethyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexyl]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 22966887 |
| Molecular Formula | C30H60N4O2 |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 508.47 |
| IUPAC Name | N-[6-[methoxymethyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]hexyl]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)acetamide |
| SMILES | COCN(CCCCCCN(C(C)=O)C1CC(C)(C)N(C)C(C)(C)C1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C30H60N4O2/c1-24(35)34(26-21-29(6,7)32(11)30(8,9)22-26)18-16-14-13-15-17-33(23-36-12)25-19-27(2,3)31(10)28(4,5)20-25/h25-26H,13-23H2,1-12H3 |
| InChIKey | ACGMNUAZUFLODC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|