C23H38O3 — CID 22966933
(9E,13E)-2,9,13-trimethyl-15-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-one (PubChem CID 22966933) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (9E,13E)-2,9,13-trimethyl-15-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-one.
| Compound Name | (9E,13E)-2,9,13-trimethyl-15-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-one |
|---|---|
| PubChem CID | 22966933 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (9E,13E)-2,9,13-trimethyl-15-(oxan-2-yloxy)pentadeca-2,9,13-trien-6-one |
| SMILES | CC(C)=CCCC(=O)CC/C(C)=C/CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C23H38O3/c1-19(2)9-7-12-22(24)15-14-20(3)10-8-11-21(4)16-18-26-23-13-5-6-17-25-23/h9-10,16,23H,5-8,11-15,17-18H2,1-4H3/b20-10+,21-16+ |
| InChIKey | XVWVSLVXVDJMFI-UYFDDYNLSA-N |
| XLogP | 6.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|