C17H30O2 — CID 22966988
(2E)-7-hydroxy-4,4,6,8-tetramethyltrideca-2,12-dien-5-one (PubChem CID 22966988) has the molecular formula C17H30O2 and a molecular weight of 266.43 g/mol. Its IUPAC name is (2E)-7-hydroxy-4,4,6,8-tetramethyltrideca-2,12-dien-5-one.
| Compound Name | (2E)-7-hydroxy-4,4,6,8-tetramethyltrideca-2,12-dien-5-one |
|---|---|
| PubChem CID | 22966988 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (2E)-7-hydroxy-4,4,6,8-tetramethyltrideca-2,12-dien-5-one |
| SMILES | C=CCCCC(C)C(O)C(C)C(=O)C(C)(C)/C=C/C |
| InChI | InChI=1S/C17H30O2/c1-7-9-10-11-13(3)15(18)14(4)16(19)17(5,6)12-8-2/h7-8,12-15,18H,1,9-11H2,2-6H3/b12-8+ |
| InChIKey | YZKJIVVHMOCALD-XYOKQWHBSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|