About (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol
(2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol (PubChem CID 22967024) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol.
Molecular Properties
| Compound Name | (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol |
| PubChem CID | 22967024 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol |
| SMILES | C[N+]1([O-])CC2(C1)OCC(CO)O2 |
| InChI | InChI=1S/C7H13NO4/c1-8(10)4-7(5-8)11-3-6(2-9)12-7/h6,9H,2-5H2,1H3 |
| InChIKey | GNPYBODXQADGJE-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 61.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol?
The IUPAC name of (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol (CID 22967024) is (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol.
What is the SMILES notation for (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol?
The canonical SMILES for (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol is C[N+]1([O-])CC2(C1)OCC(CO)O2.
What is the InChIKey of (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol?
The InChIKey is GNPYBODXQADGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-8(10)4-7(5-8)11-3-6(2-9)12-7/h6,9H,2-5H2,1H3.
What are the key properties of (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol?
(2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol has a molecular weight of 175.18 g/mol, XLogP of -0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2-oxido-5,8-dioxa-2-azoniaspiro[3.4]octan-7-yl)methanol is sourced from PubChem (CID 22967024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).