About 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide
5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide (PubChem CID 22967053) has the molecular formula C6H11NO3S
and a molecular weight of 177.22 g/mol. Its IUPAC name is 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide.
Molecular Properties
| Compound Name | 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide |
| PubChem CID | 22967053 |
| Molecular Formula | C6H11NO3S |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide |
| SMILES | C[N+]1([O-])CC2CC1CS2(=O)=O |
| InChI | InChI=1S/C6H11NO3S/c1-7(8)3-6-2-5(7)4-11(6,9)10/h5-6H,2-4H2,1H3 |
| InChIKey | DOPZEQHIECIOHY-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide?
The IUPAC name of 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide (CID 22967053) is 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide.
What is the SMILES notation for 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide?
The canonical SMILES for 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide is C[N+]1([O-])CC2CC1CS2(=O)=O.
What is the InChIKey of 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide?
The InChIKey is DOPZEQHIECIOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3S/c1-7(8)3-6-2-5(7)4-11(6,9)10/h5-6H,2-4H2,1H3.
What are the key properties of 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide?
5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide has a molecular weight of 177.22 g/mol, XLogP of -0.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-oxido-2λ6-thia-5-azoniabicyclo[2.2.1]heptane 2,2-dioxide is sourced from PubChem (CID 22967053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).