About 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate
6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 22967208) has the molecular formula C21H26N2O8
and a molecular weight of 434.45 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
Molecular Properties
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| PubChem CID | 22967208 |
| Molecular Formula | C21H26N2O8 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | O=C(CCCCCN1C(=O)C=CC1=O)OCOC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H26N2O8/c24-16-9-10-17(25)22(16)13-5-1-3-7-20(28)30-15-31-21(29)8-4-2-6-14-23-18(26)11-12-19(23)27/h9-12H,1-8,13-15H2 |
| InChIKey | GDGURLJVSVYESW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The IUPAC name of 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate (CID 22967208) is 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate.
What is the SMILES notation for 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The canonical SMILES for 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate is O=C(CCCCCN1C(=O)C=CC1=O)OCOC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate?
The InChIKey is GDGURLJVSVYESW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O8/c24-16-9-10-17(25)22(16)13-5-1-3-7-20(28)30-15-31-21(29)8-4-2-6-14-23-18(26)11-12-19(23)27/h9-12H,1-8,13-15H2.
What are the key properties of 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate?
6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate has a molecular weight of 434.45 g/mol, XLogP of 1.00, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxopyrrol-1-yl)hexanoyloxymethyl 6-(2,5-dioxopyrrol-1-yl)hexanoate is sourced from PubChem (CID 22967208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).