potassium 2H-naphthalen-2-ide

C10H7K — CID 22967220

IUPACpotassium 2H-naphthalen-2-ide
SMILES[K+].[c-]1ccc2ccccc2c1
InChIInChI=1S/C10H7.K/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-3,5-8H;/q-1;+1
InChIKeyQLMVTJYLPTZVTD-UHFFFAOYSA-N
MW166.26 g/mol
LogP-0.36
Rot. Bonds

About potassium 2H-naphthalen-2-ide

potassium 2H-naphthalen-2-ide (PubChem CID 22967220) has the molecular formula C10H7K and a molecular weight of 166.26 g/mol. Its IUPAC name is potassium 2H-naphthalen-2-ide.

Molecular Properties

Compound Namepotassium 2H-naphthalen-2-ide
PubChem CID22967220
Molecular FormulaC10H7K
Molecular Weight166.26 g/mol
Exact Mass166.02
IUPAC Namepotassium 2H-naphthalen-2-ide
SMILES[K+].[c-]1ccc2ccccc2c1
InChIInChI=1S/C10H7.K/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-3,5-8H;/q-1;+1
InChIKeyQLMVTJYLPTZVTD-UHFFFAOYSA-N
XLogP-0.36
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.26
LogP ≤ 5-0.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze potassium 2H-naphthalen-2-ide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2H-naphthalen-2-ide?
The IUPAC name of potassium 2H-naphthalen-2-ide (CID 22967220) is potassium 2H-naphthalen-2-ide.
What is the SMILES notation for potassium 2H-naphthalen-2-ide?
The canonical SMILES for potassium 2H-naphthalen-2-ide is [K+].[c-]1ccc2ccccc2c1.
What is the InChIKey of potassium 2H-naphthalen-2-ide?
The InChIKey is QLMVTJYLPTZVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7.K/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-3,5-8H;/q-1;+1.
What are the key properties of potassium 2H-naphthalen-2-ide?
potassium 2H-naphthalen-2-ide has a molecular weight of 166.26 g/mol, XLogP of -0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2H-naphthalen-2-ide is sourced from PubChem (CID 22967220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).