C10H16N2 — CID 22967243
6-methyl-1,2,3,4,4a,8a-hexahydroquinolin-5-amine (PubChem CID 22967243) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 6-methyl-1,2,3,4,4a,8a-hexahydroquinolin-5-amine.
| Compound Name | 6-methyl-1,2,3,4,4a,8a-hexahydroquinolin-5-amine |
|---|---|
| PubChem CID | 22967243 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 6-methyl-1,2,3,4,4a,8a-hexahydroquinolin-5-amine |
| SMILES | CC1=C(N)C2CCCNC2C=C1 |
| InChI | InChI=1S/C10H16N2/c1-7-4-5-9-8(10(7)11)3-2-6-12-9/h4-5,8-9,12H,2-3,6,11H2,1H3 |
| InChIKey | PQCWIUPIKOPIHC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |