C13H16F12O3 — CID 22967412
1-(1,1,2,2-tetrafluoroethoxy)-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)pentane (PubChem CID 22967412) has the molecular formula C13H16F12O3 and a molecular weight of 448.24 g/mol. Its IUPAC name is 1-(1,1,2,2-tetrafluoroethoxy)-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)pentane.
| Compound Name | 1-(1,1,2,2-tetrafluoroethoxy)-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)pentane |
|---|---|
| PubChem CID | 22967412 |
| Molecular Formula | C13H16F12O3 |
| Molecular Weight | 448.24 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 1-(1,1,2,2-tetrafluoroethoxy)-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)pentane |
| SMILES | CCCC(COC(F)(F)C(F)F)(COC(F)(F)C(F)F)COC(F)(F)C(F)F |
| InChI | InChI=1S/C13H16F12O3/c1-2-3-10(4-26-11(20,21)7(14)15,5-27-12(22,23)8(16)17)6-28-13(24,25)9(18)19/h7-9H,2-6H2,1H3 |
| InChIKey | CYXRQSSVZSCVLQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.24 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|