C12H18F8O3 — CID 22967415
1-methoxy-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)pentane (PubChem CID 22967415) has the molecular formula C12H18F8O3 and a molecular weight of 362.26 g/mol. Its IUPAC name is 1-methoxy-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)pentane.
| Compound Name | 1-methoxy-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)pentane |
|---|---|
| PubChem CID | 22967415 |
| Molecular Formula | C12H18F8O3 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 1-methoxy-2,2-bis(1,1,2,2-tetrafluoroethoxymethyl)pentane |
| SMILES | CCCC(COC)(COC(F)(F)C(F)F)COC(F)(F)C(F)F |
| InChI | InChI=1S/C12H18F8O3/c1-3-4-10(5-21-2,6-22-11(17,18)8(13)14)7-23-12(19,20)9(15)16/h8-9H,3-7H2,1-2H3 |
| InChIKey | WNDCBYSYEVVMLI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|