C17H26F2 — CID 22967461
2-ethynyl-1,3-difluoro-5-(4-propylcyclohexyl)cyclohexane (PubChem CID 22967461) has the molecular formula C17H26F2 and a molecular weight of 268.39 g/mol. Its IUPAC name is 2-ethynyl-1,3-difluoro-5-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 2-ethynyl-1,3-difluoro-5-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 22967461 |
| Molecular Formula | C17H26F2 |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-ethynyl-1,3-difluoro-5-(4-propylcyclohexyl)cyclohexane |
| SMILES | C#CC1C(F)CC(C2CCC(CCC)CC2)CC1F |
| InChI | InChI=1S/C17H26F2/c1-3-5-12-6-8-13(9-7-12)14-10-16(18)15(4-2)17(19)11-14/h2,12-17H,3,5-11H2,1H3 |
| InChIKey | UFNXTQVQVLTLSY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|