About (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate
(1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 22967746) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
Molecular Properties
| Compound Name | (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| PubChem CID | 22967746 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC1(OC(=O)C2CC3CC2C2C4C=CC(C4)C32)C=CCC1 |
| InChI | InChI=1S/C19H24O2/c1-19(6-2-3-7-19)21-18(20)15-10-13-9-14(15)17-12-5-4-11(8-12)16(13)17/h2,4-6,11-17H,3,7-10H2,1H3 |
| InChIKey | LHRUAMCCIMPBDG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The IUPAC name of (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (CID 22967746) is (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
What is the SMILES notation for (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The canonical SMILES for (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate is CC1(OC(=O)C2CC3CC2C2C4C=CC(C4)C32)C=CCC1.
What is the InChIKey of (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
The InChIKey is LHRUAMCCIMPBDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O2/c1-19(6-2-3-7-19)21-18(20)15-10-13-9-14(15)17-12-5-4-11(8-12)16(13)17/h2,4-6,11-17H,3,7-10H2,1H3.
What are the key properties of (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate?
(1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate has a molecular weight of 284.40 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopent-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate is sourced from PubChem (CID 22967746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).