C22H32O2 — CID 22967752
(1-ethylcyclopent-2-en-1-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 22967752) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (1-ethylcyclopent-2-en-1-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | (1-ethylcyclopent-2-en-1-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 22967752 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (1-ethylcyclopent-2-en-1-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CCC1(OC(=O)C2CC3CC2C2C4CC(C(C)C4C)C32)C=CCC1 |
| InChI | InChI=1S/C22H32O2/c1-4-22(7-5-6-8-22)24-21(23)18-10-14-9-17(18)20-16-11-15(19(14)20)12(2)13(16)3/h5,7,12-20H,4,6,8-11H2,1-3H3 |
| InChIKey | XBACWMZTIKNYSL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|