C24H26ClN3O6S — CID 22967829
N-[2-chloro-5-hydroxy-4-[[3-(methanesulfonamido)phenoxy]methylamino]phenyl]-2-(4-methylphenoxy)propanamide (PubChem CID 22967829) has the molecular formula C24H26ClN3O6S and a molecular weight of 520.01 g/mol. Its IUPAC name is N-[2-chloro-5-hydroxy-4-[[3-(methanesulfonamido)phenoxy]methylamino]phenyl]-2-(4-methylphenoxy)propanamide.
| Compound Name | N-[2-chloro-5-hydroxy-4-[[3-(methanesulfonamido)phenoxy]methylamino]phenyl]-2-(4-methylphenoxy)propanamide |
|---|---|
| PubChem CID | 22967829 |
| Molecular Formula | C24H26ClN3O6S |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | N-[2-chloro-5-hydroxy-4-[[3-(methanesulfonamido)phenoxy]methylamino]phenyl]-2-(4-methylphenoxy)propanamide |
| SMILES | Cc1ccc(OC(C)C(=O)Nc2cc(O)c(NCOc3cccc(NS(C)(=O)=O)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C24H26ClN3O6S/c1-15-7-9-18(10-8-15)34-16(2)24(30)27-21-13-23(29)22(12-20(21)25)26-14-33-19-6-4-5-17(11-19)28-35(3,31)32/h4-13,16,26,28-29H,14H2,1-3H3,(H,27,30) |
| InChIKey | DFKCOMGJMCOLBF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|