C4H9F3N2O4S2 — CID 22967974
2,2,2-trifluoro-1-N,1-N'-dimethylethane-1,1-disulfonamide (PubChem CID 22967974) has the molecular formula C4H9F3N2O4S2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-N,1-N'-dimethylethane-1,1-disulfonamide.
| Compound Name | 2,2,2-trifluoro-1-N,1-N'-dimethylethane-1,1-disulfonamide |
|---|---|
| PubChem CID | 22967974 |
| Molecular Formula | C4H9F3N2O4S2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 2,2,2-trifluoro-1-N,1-N'-dimethylethane-1,1-disulfonamide |
| SMILES | CNS(=O)(=O)C(C(F)(F)F)S(=O)(=O)NC |
| InChI | InChI=1S/C4H9F3N2O4S2/c1-8-14(10,11)3(4(5,6)7)15(12,13)9-2/h3,8-9H,1-2H3 |
| InChIKey | PLMBKAFYOVPUNY-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |