About [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate
[4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate (PubChem CID 22968444) has the molecular formula C16H13N2OS+
and a molecular weight of 281.36 g/mol. Its IUPAC name is [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate.
Molecular Properties
| Compound Name | [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate |
| PubChem CID | 22968444 |
| Molecular Formula | C16H13N2OS+ |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate |
| SMILES | Cc1cccc2c1OC[N+](c1ccc(SC#N)cc1)=C2 |
| InChI | InChI=1S/C16H13N2OS/c1-12-3-2-4-13-9-18(11-19-16(12)13)14-5-7-15(8-6-14)20-10-17/h2-9H,11H2,1H3/q+1 |
| InChIKey | SAKLETYYDPJPQQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate?
The IUPAC name of [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate (CID 22968444) is [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate.
What is the SMILES notation for [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate?
The canonical SMILES for [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate is Cc1cccc2c1OC[N+](c1ccc(SC#N)cc1)=C2.
What is the InChIKey of [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate?
The InChIKey is SAKLETYYDPJPQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N2OS/c1-12-3-2-4-13-9-18(11-19-16(12)13)14-5-7-15(8-6-14)20-10-17/h2-9H,11H2,1H3/q+1.
What are the key properties of [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate?
[4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate has a molecular weight of 281.36 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] thiocyanate is sourced from PubChem (CID 22968444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).