About 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile
3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile (PubChem CID 22968572) has the molecular formula C15H11N2O+
and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile.
Molecular Properties
| Compound Name | 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile |
| PubChem CID | 22968572 |
| Molecular Formula | C15H11N2O+ |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile |
| SMILES | N#Cc1cccc2c1OC[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C15H11N2O/c16-9-12-5-4-6-13-10-17(11-18-15(12)13)14-7-2-1-3-8-14/h1-8,10H,11H2/q+1 |
| InChIKey | HCYNTKIHDNBKAP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile?
The IUPAC name of 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile (CID 22968572) is 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile.
What is the SMILES notation for 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile?
The canonical SMILES for 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile is N#Cc1cccc2c1OC[N+](c1ccccc1)=C2.
What is the InChIKey of 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile?
The InChIKey is HCYNTKIHDNBKAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N2O/c16-9-12-5-4-6-13-10-17(11-18-15(12)13)14-7-2-1-3-8-14/h1-8,10H,11H2/q+1.
What are the key properties of 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile?
3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile has a molecular weight of 235.27 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbonitrile is sourced from PubChem (CID 22968572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).