C27H18N2O2+2 — CID 22968631
2,13-diphenyl-14,19-dioxa-2,13-diazoniapentacyclo[6.5.3.31,7.011,15.04,18]nonadeca-2,4(18),5,7(17),8(16),9,11(15),12-octaene (PubChem CID 22968631) has the molecular formula C27H18N2O2+2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2,13-diphenyl-14,19-dioxa-2,13-diazoniapentacyclo[6.5.3.31,7.011,15.04,18]nonadeca-2,4(18),5,7(17),8(16),9,11(15),12-octaene.
| Compound Name | 2,13-diphenyl-14,19-dioxa-2,13-diazoniapentacyclo[6.5.3.31,7.011,15.04,18]nonadeca-2,4(18),5,7(17),8(16),9,11(15),12-octaene |
|---|---|
| PubChem CID | 22968631 |
| Molecular Formula | C27H18N2O2+2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2,13-diphenyl-14,19-dioxa-2,13-diazoniapentacyclo[6.5.3.31,7.011,15.04,18]nonadeca-2,4(18),5,7(17),8(16),9,11(15),12-octaene |
| SMILES | C1=[N+](c2ccccc2)C23Oc4cc(ccc41)-c1ccc(c(c1)O2)C=[N+]3c1ccccc1 |
| InChI | InChI=1S/C27H18N2O2/c1-3-7-23(8-4-1)28-17-21-13-11-19-15-25(21)30-27(28)29(24-9-5-2-6-10-24)18-22-14-12-20(19)16-26(22)31-27/h1-18H/q+2 |
| InChIKey | WFGXLSQJCNVAEE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|