C29H22N2O2+2 — CID 22968692
4',11-dimethylspiro[9-oxa-7-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12,14,16-octaene-8,6'-pyrido[1,2-c][1,3]benzoxazin-7-ium] (PubChem CID 22968692) has the molecular formula C29H22N2O2+2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4',11-dimethylspiro[9-oxa-7-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12,14,16-octaene-8,6'-pyrido[1,2-c][1,3]benzoxazin-7-ium].
| Compound Name | 4',11-dimethylspiro[9-oxa-7-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12,14,16-octaene-8,6'-pyrido[1,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 22968692 |
| Molecular Formula | C29H22N2O2+2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 4',11-dimethylspiro[9-oxa-7-azoniatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12,14,16-octaene-8,6'-pyrido[1,2-c][1,3]benzoxazin-7-ium] |
| SMILES | Cc1cccc2c1OC1(Oc3c(cc4ccccc4c3C)-c3cccc[n+]31)[n+]1ccccc1-2 |
| InChI | InChI=1S/C29H22N2O2/c1-19-10-9-13-23-25-14-5-7-16-30(25)29(32-27(19)23)31-17-8-6-15-26(31)24-18-21-11-3-4-12-22(21)20(2)28(24)33-29/h3-18H,1-2H3/q+2 |
| InChIKey | KSVISXYGKKXGGC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|