C31H24N2O2+2 — CID 22968693
4,4'-dimethyl-2'-phenyl-6,6'-spirobi[pyrido[1,2-c][1,3]benzoxazin-7-ium] (PubChem CID 22968693) has the molecular formula C31H24N2O2+2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 4,4'-dimethyl-2'-phenyl-6,6'-spirobi[pyrido[1,2-c][1,3]benzoxazin-7-ium].
| Compound Name | 4,4'-dimethyl-2'-phenyl-6,6'-spirobi[pyrido[1,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 22968693 |
| Molecular Formula | C31H24N2O2+2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4,4'-dimethyl-2'-phenyl-6,6'-spirobi[pyrido[1,2-c][1,3]benzoxazin-7-ium] |
| SMILES | Cc1cccc2c1OC1(Oc3c(C)cc(-c4ccccc4)cc3-c3cccc[n+]31)[n+]1ccccc1-2 |
| InChI | InChI=1S/C31H24N2O2/c1-21-11-10-14-25-27-15-6-8-17-32(27)31(34-29(21)25)33-18-9-7-16-28(33)26-20-24(19-22(2)30(26)35-31)23-12-4-3-5-13-23/h3-20H,1-2H3/q+2 |
| InChIKey | OLKBZXOGJYHLBK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|