About N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate
N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate (PubChem CID 22968723) has the molecular formula C16H27Cl2NOTi
and a molecular weight of 368.17 g/mol. Its IUPAC name is N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate.
Molecular Properties
| Compound Name | N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate |
| PubChem CID | 22968723 |
| Molecular Formula | C16H27Cl2NOTi |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate |
| SMILES | Cc1c(/C=N\C(C)(C)C)cccc1C(C)(C)C.Cl[Ti]Cl.O |
| InChI | InChI=1S/C16H25N.2ClH.H2O.Ti/c1-12-13(11-17-16(5,6)7)9-8-10-14(12)15(2,3)4;;;;/h8-11H,1-7H3;2*1H;1H2;/q;;;;+2/p-2/b17-11-;;;; |
| InChIKey | DZFATYNCCUAQEQ-LNDDYWTCSA-L |
| XLogP | 5.06 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate?
The IUPAC name of N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate (CID 22968723) is N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate.
What is the SMILES notation for N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate?
The canonical SMILES for N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate is Cc1c(/C=N\C(C)(C)C)cccc1C(C)(C)C.Cl[Ti]Cl.O.
What is the InChIKey of N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate?
The InChIKey is DZFATYNCCUAQEQ-LNDDYWTCSA-L. The full InChI is InChI=1S/C16H25N.2ClH.H2O.Ti/c1-12-13(11-17-16(5,6)7)9-8-10-14(12)15(2,3)4;;;;/h8-11H,1-7H3;2*1H;1H2;/q;;;;+2/p-2/b17-11-;;;;.
What are the key properties of N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate?
N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate has a molecular weight of 368.17 g/mol, XLogP of 5.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-(3-tert-butyl-2-methylphenyl)methanimine;dichlorotitanium;hydrate is sourced from PubChem (CID 22968723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).