About N,2,6-trimethyloxan-3-amine
N,2,6-trimethyloxan-3-amine (PubChem CID 22969195) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is N,2,6-trimethyloxan-3-amine.
Molecular Properties
| Compound Name | N,2,6-trimethyloxan-3-amine |
| PubChem CID | 22969195 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N,2,6-trimethyloxan-3-amine |
| SMILES | CNC1CCC(C)OC1C |
| InChI | InChI=1S/C8H17NO/c1-6-4-5-8(9-3)7(2)10-6/h6-9H,4-5H2,1-3H3 |
| InChIKey | WFBAWGLDFIXKNX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,2,6-trimethyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2,6-trimethyloxan-3-amine?
The IUPAC name of N,2,6-trimethyloxan-3-amine (CID 22969195) is N,2,6-trimethyloxan-3-amine.
What is the SMILES notation for N,2,6-trimethyloxan-3-amine?
The canonical SMILES for N,2,6-trimethyloxan-3-amine is CNC1CCC(C)OC1C.
What is the InChIKey of N,2,6-trimethyloxan-3-amine?
The InChIKey is WFBAWGLDFIXKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-6-4-5-8(9-3)7(2)10-6/h6-9H,4-5H2,1-3H3.
What are the key properties of N,2,6-trimethyloxan-3-amine?
N,2,6-trimethyloxan-3-amine has a molecular weight of 143.23 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2,6-trimethyloxan-3-amine is sourced from PubChem (CID 22969195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).