About N-ethyl-2,6-dimethyloxan-3-amine
N-ethyl-2,6-dimethyloxan-3-amine (PubChem CID 22969198) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is N-ethyl-2,6-dimethyloxan-3-amine.
Molecular Properties
| Compound Name | N-ethyl-2,6-dimethyloxan-3-amine |
| PubChem CID | 22969198 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | N-ethyl-2,6-dimethyloxan-3-amine |
| SMILES | CCNC1CCC(C)OC1C |
| InChI | InChI=1S/C9H19NO/c1-4-10-9-6-5-7(2)11-8(9)3/h7-10H,4-6H2,1-3H3 |
| InChIKey | YJNZSGSEHQJFPG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2,6-dimethyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,6-dimethyloxan-3-amine?
The IUPAC name of N-ethyl-2,6-dimethyloxan-3-amine (CID 22969198) is N-ethyl-2,6-dimethyloxan-3-amine.
What is the SMILES notation for N-ethyl-2,6-dimethyloxan-3-amine?
The canonical SMILES for N-ethyl-2,6-dimethyloxan-3-amine is CCNC1CCC(C)OC1C.
What is the InChIKey of N-ethyl-2,6-dimethyloxan-3-amine?
The InChIKey is YJNZSGSEHQJFPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-4-10-9-6-5-7(2)11-8(9)3/h7-10H,4-6H2,1-3H3.
What are the key properties of N-ethyl-2,6-dimethyloxan-3-amine?
N-ethyl-2,6-dimethyloxan-3-amine has a molecular weight of 157.26 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,6-dimethyloxan-3-amine is sourced from PubChem (CID 22969198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).