C26H32F4N4OSi — CID 22969433
2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 22969433) has the molecular formula C26H32F4N4OSi and a molecular weight of 520.65 g/mol. Its IUPAC name is 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 22969433 |
| Molecular Formula | C26H32F4N4OSi |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(C(F)(F)F)c2)nc1N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H32F4N4OSi/c1-36(2,3)16-15-35-19-34-18-23(20-7-6-8-21(17-20)26(28,29)30)31-25(34)33-13-11-32(12-14-33)24-10-5-4-9-22(24)27/h4-10,17-18H,11-16,19H2,1-3H3 |
| InChIKey | LBWIDTUJNMLXGH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|