C25H31F4N5OSi — CID 22969437
2-[[2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 22969437) has the molecular formula C25H31F4N5OSi and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-[[2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 22969437 |
| Molecular Formula | C25H31F4N5OSi |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-[[2-[4-(5-fluoro-2-pyridinyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(C(F)(F)F)c2)nc1N1CCN(c2ccc(F)cn2)CC1 |
| InChI | InChI=1S/C25H31F4N5OSi/c1-36(2,3)14-13-35-18-34-17-22(19-5-4-6-20(15-19)25(27,28)29)31-24(34)33-11-9-32(10-12-33)23-8-7-21(26)16-30-23/h4-8,15-17H,9-14,18H2,1-3H3 |
| InChIKey | HHQJCBXDIZJUDC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|