C21H25F3N4OSi — CID 22969463
5-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyridin-3-amine (PubChem CID 22969463) has the molecular formula C21H25F3N4OSi and a molecular weight of 434.54 g/mol. Its IUPAC name is 5-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyridin-3-amine.
| Compound Name | 5-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 22969463 |
| Molecular Formula | C21H25F3N4OSi |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 5-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]pyridin-3-amine |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(C(F)(F)F)c2)nc1-c1cncc(N)c1 |
| InChI | InChI=1S/C21H25F3N4OSi/c1-30(2,3)8-7-29-14-28-13-19(15-5-4-6-17(9-15)21(22,23)24)27-20(28)16-10-18(25)12-26-11-16/h4-6,9-13H,7-8,14,25H2,1-3H3 |
| InChIKey | RCBQHIXAIJIQQR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|