C26H34F3N5OSi — CID 22969511
trimethyl-[2-[[2-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 22969511) has the molecular formula C26H34F3N5OSi and a molecular weight of 517.67 g/mol. Its IUPAC name is trimethyl-[2-[[2-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[2-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 22969511 |
| Molecular Formula | C26H34F3N5OSi |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | trimethyl-[2-[[2-[4-(6-methyl-2-pyridinyl)piperazin-1-yl]-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1cccc(N2CCN(c3nc(-c4cccc(C(F)(F)F)c4)cn3COCC[Si](C)(C)C)CC2)n1 |
| InChI | InChI=1S/C26H34F3N5OSi/c1-20-7-5-10-24(30-20)32-11-13-33(14-12-32)25-31-23(18-34(25)19-35-15-16-36(2,3)4)21-8-6-9-22(17-21)26(27,28)29/h5-10,17-18H,11-16,19H2,1-4H3 |
| InChIKey | KQLUFIACEGTMSE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|