C26H31F6N5OSi — CID 22969521
trimethyl-[2-[[4-[3-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]imidazol-1-yl]methoxy]ethyl]silane (PubChem CID 22969521) has the molecular formula C26H31F6N5OSi and a molecular weight of 571.64 g/mol. Its IUPAC name is trimethyl-[2-[[4-[3-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]imidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-[3-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]imidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 22969521 |
| Molecular Formula | C26H31F6N5OSi |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | trimethyl-[2-[[4-[3-(trifluoromethyl)phenyl]-2-[4-[3-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]imidazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(C(F)(F)F)c2)nc1N1CCN(c2ncccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H31F6N5OSi/c1-39(2,3)15-14-38-18-37-17-22(19-6-4-7-20(16-19)25(27,28)29)34-24(37)36-12-10-35(11-13-36)23-21(26(30,31)32)8-5-9-33-23/h4-9,16-17H,10-15,18H2,1-3H3 |
| InChIKey | RNXBURMXZAKZRA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|