C15H18O3 — CID 22970314
2-(3-hydroxy-3-phenyl-2-bicyclo[2.2.1]heptanyl)acetic acid (PubChem CID 22970314) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-(3-hydroxy-3-phenyl-2-bicyclo[2.2.1]heptanyl)acetic acid.
| Compound Name | 2-(3-hydroxy-3-phenyl-2-bicyclo[2.2.1]heptanyl)acetic acid |
|---|---|
| PubChem CID | 22970314 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-(3-hydroxy-3-phenyl-2-bicyclo[2.2.1]heptanyl)acetic acid |
| SMILES | O=C(O)CC1C2CCC(C2)C1(O)c1ccccc1 |
| InChI | InChI=1S/C15H18O3/c16-14(17)9-13-10-6-7-12(8-10)15(13,18)11-4-2-1-3-5-11/h1-5,10,12-13,18H,6-9H2,(H,16,17) |
| InChIKey | HIYDIQQFTDAPCQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |