C48H93N9O3 — CID 22970666
2-[4-[[4,6-bis[butyl-[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-butylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol (PubChem CID 22970666) has the molecular formula C48H93N9O3 and a molecular weight of 844.33 g/mol. Its IUPAC name is 2-[4-[[4,6-bis[butyl-[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-butylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol.
| Compound Name | 2-[4-[[4,6-bis[butyl-[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-butylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 22970666 |
| Molecular Formula | C48H93N9O3 |
| Molecular Weight | 844.33 g/mol |
| Exact Mass | 843.74 |
| IUPAC Name | 2-[4-[[4,6-bis[butyl-[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,3,5-triazin-2-yl]-butylamino]-2,2,6,6-tetramethylpiperidin-1-yl]ethanol |
| SMILES | CCCCN(c1nc(N(CCCC)C2CC(C)(C)N(CCO)C(C)(C)C2)nc(N(CCCC)C2CC(C)(C)N(CCO)C(C)(C)C2)n1)C1CC(C)(C)N(CCO)C(C)(C)C1 |
| InChI | InChI=1S/C48H93N9O3/c1-16-19-22-52(37-31-43(4,5)55(25-28-58)44(6,7)32-37)40-49-41(53(23-20-17-2)38-33-45(8,9)56(26-29-59)46(10,11)34-38)51-42(50-40)54(24-21-18-3)39-35-47(12,13)57(27-30-60)48(14,15)36-39/h37-39,58-60H,16-36H2,1-15H3 |
| InChIKey | LUSLAELTROSENX-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.33 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |