C21H22Cl2O5 — CID 22970686
[(4R,4aS,8aS)-6-(3,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]methanol (PubChem CID 22970686) has the molecular formula C21H22Cl2O5 and a molecular weight of 425.31 g/mol. Its IUPAC name is [(4R,4aS,8aS)-6-(3,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]methanol.
| Compound Name | [(4R,4aS,8aS)-6-(3,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]methanol |
|---|---|
| PubChem CID | 22970686 |
| Molecular Formula | C21H22Cl2O5 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | [(4R,4aS,8aS)-6-(3,4-dichlorophenyl)-2-(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]methanol |
| SMILES | Cc1ccc(C2O[C@H]3COC(c4ccc(Cl)c(Cl)c4)O[C@H]3[C@@H](CO)O2)cc1C |
| InChI | InChI=1S/C21H22Cl2O5/c1-11-3-4-13(7-12(11)2)21-26-17(9-24)19-18(27-21)10-25-20(28-19)14-5-6-15(22)16(23)8-14/h3-8,17-21,24H,9-10H2,1-2H3/t17-,18+,19+,20?,21?/m1/s1 |
| InChIKey | RIVBOQVFLQTGHO-GBYQISHSSA-N |
| XLogP | 4.50 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |