C16H20N6O2S2 — CID 22970842
1-[5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-3-(3-imidazol-1-ylpropyl)urea (PubChem CID 22970842) has the molecular formula C16H20N6O2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-[5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-3-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-[5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-3-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 22970842 |
| Molecular Formula | C16H20N6O2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 1-[5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-3-(3-imidazol-1-ylpropyl)urea |
| SMILES | CCc1cnc(CSc2cnc(NC(=O)NCCCn3ccnc3)s2)o1 |
| InChI | InChI=1S/C16H20N6O2S2/c1-2-12-8-19-13(24-12)10-25-14-9-20-16(26-14)21-15(23)18-4-3-6-22-7-5-17-11-22/h5,7-9,11H,2-4,6,10H2,1H3,(H2,18,20,21,23) |
| InChIKey | VKJSJJDTQZYIHD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|