C24H32N4O2S3 — CID 22970932
S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-[3-[[2-(dimethylamino)ethylamino]methyl]phenyl]ethanethioate (PubChem CID 22970932) has the molecular formula C24H32N4O2S3 and a molecular weight of 504.75 g/mol. Its IUPAC name is S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-[3-[[2-(dimethylamino)ethylamino]methyl]phenyl]ethanethioate.
| Compound Name | S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-[3-[[2-(dimethylamino)ethylamino]methyl]phenyl]ethanethioate |
|---|---|
| PubChem CID | 22970932 |
| Molecular Formula | C24H32N4O2S3 |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-[3-[[2-(dimethylamino)ethylamino]methyl]phenyl]ethanethioate |
| SMILES | CN(C)CCNCc1cccc(CC(=O)Sc2ncc(SCc3ncc(C(C)(C)C)o3)s2)c1 |
| InChI | InChI=1S/C24H32N4O2S3/c1-24(2,3)19-14-26-20(30-19)16-31-22-15-27-23(33-22)32-21(29)12-17-7-6-8-18(11-17)13-25-9-10-28(4)5/h6-8,11,14-15,25H,9-10,12-13,16H2,1-5H3 |
| InChIKey | QWLDYWCNJFTHLX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|