C21H24N2O2S3 — CID 22970952
S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-(3-ethylphenyl)ethanethioate (PubChem CID 22970952) has the molecular formula C21H24N2O2S3 and a molecular weight of 432.64 g/mol. Its IUPAC name is S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-(3-ethylphenyl)ethanethioate.
| Compound Name | S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-(3-ethylphenyl)ethanethioate |
|---|---|
| PubChem CID | 22970952 |
| Molecular Formula | C21H24N2O2S3 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-(3-ethylphenyl)ethanethioate |
| SMILES | CCc1cccc(CC(=O)Sc2ncc(SCc3ncc(C(C)(C)C)o3)s2)c1 |
| InChI | InChI=1S/C21H24N2O2S3/c1-5-14-7-6-8-15(9-14)10-18(24)27-20-23-12-19(28-20)26-13-17-22-11-16(25-17)21(2,3)4/h6-9,11-12H,5,10,13H2,1-4H3 |
| InChIKey | VCNZELCMIDRPBC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|