C24H29N3O2S3 — CID 22970957
S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-[3-(pyrrolidin-1-ylmethyl)phenyl]ethanethioate (PubChem CID 22970957) has the molecular formula C24H29N3O2S3 and a molecular weight of 487.72 g/mol. Its IUPAC name is S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-[3-(pyrrolidin-1-ylmethyl)phenyl]ethanethioate.
| Compound Name | S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-[3-(pyrrolidin-1-ylmethyl)phenyl]ethanethioate |
|---|---|
| PubChem CID | 22970957 |
| Molecular Formula | C24H29N3O2S3 |
| Molecular Weight | 487.72 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | S-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl] 2-[3-(pyrrolidin-1-ylmethyl)phenyl]ethanethioate |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(SC(=O)Cc3cccc(CN4CCCC4)c3)s2)o1 |
| InChI | InChI=1S/C24H29N3O2S3/c1-24(2,3)19-13-25-20(29-19)16-30-22-14-26-23(32-22)31-21(28)12-17-7-6-8-18(11-17)15-27-9-4-5-10-27/h6-8,11,13-14H,4-5,9-10,12,15-16H2,1-3H3 |
| InChIKey | YKGKYBIIMFDSLX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|