About 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine
5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine (PubChem CID 22971176) has the molecular formula C13H19N3OS2
and a molecular weight of 297.45 g/mol. Its IUPAC name is 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine |
| PubChem CID | 22971176 |
| Molecular Formula | C13H19N3OS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine |
| SMILES | CCc1cnc(CSc2cnc(NCC(C)C)s2)o1 |
| InChI | InChI=1S/C13H19N3OS2/c1-4-10-6-14-11(17-10)8-18-12-7-16-13(19-12)15-5-9(2)3/h6-7,9H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | XEQPEXDYCWMKNA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine?
The IUPAC name of 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine (CID 22971176) is 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine?
The canonical SMILES for 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine is CCc1cnc(CSc2cnc(NCC(C)C)s2)o1.
What is the InChIKey of 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine?
The InChIKey is XEQPEXDYCWMKNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3OS2/c1-4-10-6-14-11(17-10)8-18-12-7-16-13(19-12)15-5-9(2)3/h6-7,9H,4-5,8H2,1-3H3,(H,15,16).
What are the key properties of 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine?
5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine has a molecular weight of 297.45 g/mol, XLogP of 4.05, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-ethyl-1,3-oxazol-2-yl)methylsulfanyl]-N-(2-methylpropyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 22971176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).