C26H36N3O2S3+ — CID 22971191
[4-[2-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]sulfanyl]-2-oxoethyl]phenyl]methyl-triethylazanium (PubChem CID 22971191) has the molecular formula C26H36N3O2S3+ and a molecular weight of 518.79 g/mol. Its IUPAC name is [4-[2-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]sulfanyl]-2-oxoethyl]phenyl]methyl-triethylazanium.
| Compound Name | [4-[2-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]sulfanyl]-2-oxoethyl]phenyl]methyl-triethylazanium |
|---|---|
| PubChem CID | 22971191 |
| Molecular Formula | C26H36N3O2S3+ |
| Molecular Weight | 518.79 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | [4-[2-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]sulfanyl]-2-oxoethyl]phenyl]methyl-triethylazanium |
| SMILES | CC[N+](CC)(CC)Cc1ccc(CC(=O)Sc2ncc(SCc3ncc(C(C)(C)C)o3)s2)cc1 |
| InChI | InChI=1S/C26H36N3O2S3/c1-7-29(8-2,9-3)17-20-12-10-19(11-13-20)14-23(30)33-25-28-16-24(34-25)32-18-22-27-15-21(31-22)26(4,5)6/h10-13,15-16H,7-9,14,17-18H2,1-6H3/q+1 |
| InChIKey | VXTQBCSBQJCLCX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.79 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|