C8H15NO2 — CID 22971630
2-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)acetaldehyde (PubChem CID 22971630) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)acetaldehyde.
| Compound Name | 2-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)acetaldehyde |
|---|---|
| PubChem CID | 22971630 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2-(2,2,3-trimethyl-1,3-oxazolidin-4-yl)acetaldehyde |
| SMILES | CN1C(CC=O)COC1(C)C |
| InChI | InChI=1S/C8H15NO2/c1-8(2)9(3)7(4-5-10)6-11-8/h5,7H,4,6H2,1-3H3 |
| InChIKey | HYZNMKXXPYJMLW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|