About sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate
sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate (PubChem CID 22972169) has the molecular formula C8H5N2NaO3S4
and a molecular weight of 328.40 g/mol. Its IUPAC name is sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate.
Molecular Properties
| Compound Name | sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate |
| PubChem CID | 22972169 |
| Molecular Formula | C8H5N2NaO3S4 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(Sc2n[nH]c(=S)s2)cc1.[Na+] |
| InChI | InChI=1S/C8H6N2O3S4.Na/c11-17(12,13)6-3-1-5(2-4-6)15-8-10-9-7(14)16-8;/h1-4H,(H,9,14)(H,11,12,13);/q;+1/p-1 |
| InChIKey | NKFWCXVUOVPJNY-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate?
The IUPAC name of sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate (CID 22972169) is sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate.
What is the SMILES notation for sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate?
The canonical SMILES for sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate is O=S(=O)([O-])c1ccc(Sc2n[nH]c(=S)s2)cc1.[Na+].
What is the InChIKey of sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate?
The InChIKey is NKFWCXVUOVPJNY-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6N2O3S4.Na/c11-17(12,13)6-3-1-5(2-4-6)15-8-10-9-7(14)16-8;/h1-4H,(H,9,14)(H,11,12,13);/q;+1/p-1.
What are the key properties of sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate?
sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate has a molecular weight of 328.40 g/mol, XLogP of -0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]benzenesulfonate is sourced from PubChem (CID 22972169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).