C13H22N2O — CID 22972713
7-tert-butyl-2,3,4,7,8,10a-hexahydro-1H-pyrazino[1,2-a]azepin-6-one (PubChem CID 22972713) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 7-tert-butyl-2,3,4,7,8,10a-hexahydro-1H-pyrazino[1,2-a]azepin-6-one.
| Compound Name | 7-tert-butyl-2,3,4,7,8,10a-hexahydro-1H-pyrazino[1,2-a]azepin-6-one |
|---|---|
| PubChem CID | 22972713 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 7-tert-butyl-2,3,4,7,8,10a-hexahydro-1H-pyrazino[1,2-a]azepin-6-one |
| SMILES | CC(C)(C)C1CC=CC2CNCCN2C1=O |
| InChI | InChI=1S/C13H22N2O/c1-13(2,3)11-6-4-5-10-9-14-7-8-15(10)12(11)16/h4-5,10-11,14H,6-9H2,1-3H3 |
| InChIKey | BJXDHKFQOHOSIM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|