C14H23NO — CID 22972718
7-tert-butyl-2,3,4,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-6-one (PubChem CID 22972718) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 7-tert-butyl-2,3,4,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-6-one.
| Compound Name | 7-tert-butyl-2,3,4,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-6-one |
|---|---|
| PubChem CID | 22972718 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 7-tert-butyl-2,3,4,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-6-one |
| SMILES | CC(C)(C)C1CC=CC2CCCCN2C1=O |
| InChI | InChI=1S/C14H23NO/c1-14(2,3)12-9-6-8-11-7-4-5-10-15(11)13(12)16/h6,8,11-12H,4-5,7,9-10H2,1-3H3 |
| InChIKey | WUZICCPKIIWEIH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|