C10H19N3O — CID 22972813
1,3,4a-trimethyl-4,5,6,7,8,8a-hexahydropyrido[4,3-d]pyrimidin-2-one (PubChem CID 22972813) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1,3,4a-trimethyl-4,5,6,7,8,8a-hexahydropyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 1,3,4a-trimethyl-4,5,6,7,8,8a-hexahydropyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 22972813 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1,3,4a-trimethyl-4,5,6,7,8,8a-hexahydropyrido[4,3-d]pyrimidin-2-one |
| SMILES | CN1CC2(C)CNCCC2N(C)C1=O |
| InChI | InChI=1S/C10H19N3O/c1-10-6-11-5-4-8(10)13(3)9(14)12(2)7-10/h8,11H,4-7H2,1-3H3 |
| InChIKey | ZPWITVCWCRQLJR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |