C19H31F4NO — CID 22973027
2-(tert-butylamino)-4,4-dimethyl-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one (PubChem CID 22973027) has the molecular formula C19H31F4NO and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-(tert-butylamino)-4,4-dimethyl-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one.
| Compound Name | 2-(tert-butylamino)-4,4-dimethyl-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one |
|---|---|
| PubChem CID | 22973027 |
| Molecular Formula | C19H31F4NO |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 2-(tert-butylamino)-4,4-dimethyl-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one |
| SMILES | CC(C)(C)NC(CC1CCC2(CC1)C(F)(F)C2(F)F)C(=O)C(C)(C)C |
| InChI | InChI=1S/C19H31F4NO/c1-15(2,3)14(25)13(24-16(4,5)6)11-12-7-9-17(10-8-12)18(20,21)19(17,22)23/h12-13,24H,7-11H2,1-6H3 |
| InChIKey | HSWUDOXEMVPYKN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|