C15H21ClN4O5S — CID 22973224
(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (PubChem CID 22973224) has the molecular formula C15H21ClN4O5S and a molecular weight of 404.88 g/mol. Its IUPAC name is (3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol.
| Compound Name | (3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 22973224 |
| Molecular Formula | C15H21ClN4O5S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | (3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(N[C@@H]2C[C@H](O)[C@H]3OC(C)(C)O[C@H]32)n1 |
| InChI | InChI=1S/C15H21ClN4O5S/c1-4-5-26-14-18-12(16)9(20(22)23)13(19-14)17-7-6-8(21)11-10(7)24-15(2,3)25-11/h7-8,10-11,21H,4-6H2,1-3H3,(H,17,18,19)/t7-,8+,10+,11-/m1/s1 |
| InChIKey | VVJMRWIHZWNKGF-YKDSUIRESA-N |
| XLogP | 2.61 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|