C15H26N2O3 — CID 22973498
1-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 22973498) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22973498 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(1-hydroxy-2,2,3,5,6,6-hexamethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CC1C(N2C(=O)CCC2=O)C(C)C(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C15H26N2O3/c1-9-13(16-11(18)7-8-12(16)19)10(2)15(5,6)17(20)14(9,3)4/h9-10,13,20H,7-8H2,1-6H3 |
| InChIKey | PDUZHVWCRVNEAW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|